C12H16N6 — CID 103204435
N-(4-methylpiperazin-1-yl)-1,2,4-benzotriazin-3-amine (PubChem CID 103204435) has the molecular formula C12H16N6 and a molecular weight of 244.30 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-1,2,4-benzotriazin-3-amine.
| Compound Name | N-(4-methylpiperazin-1-yl)-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 103204435 |
| Molecular Formula | C12H16N6 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-1,2,4-benzotriazin-3-amine |
| SMILES | CN1CCN(Nc2nnc3ccccc3n2)CC1 |
| InChI | InChI=1S/C12H16N6/c1-17-6-8-18(9-7-17)16-12-13-10-4-2-3-5-11(10)14-15-12/h2-5H,6-9H2,1H3,(H,13,15,16) |
| InChIKey | TVFCDVHTHDKXTO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |