C25H26N6O — CID 140543173
N-(4-methylpiperazin-1-yl)-6-(6-phenylmethoxy-3-pyridinyl)quinazolin-2-amine (PubChem CID 140543173) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-6-(6-phenylmethoxy-3-pyridinyl)quinazolin-2-amine.
| Compound Name | N-(4-methylpiperazin-1-yl)-6-(6-phenylmethoxy-3-pyridinyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 140543173 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-6-(6-phenylmethoxy-3-pyridinyl)quinazolin-2-amine |
| SMILES | CN1CCN(Nc2ncc3cc(-c4ccc(OCc5ccccc5)nc4)ccc3n2)CC1 |
| InChI | InChI=1S/C25H26N6O/c1-30-11-13-31(14-12-30)29-25-27-17-22-15-20(7-9-23(22)28-25)21-8-10-24(26-16-21)32-18-19-5-3-2-4-6-19/h2-10,15-17H,11-14,18H2,1H3,(H,27,28,29) |
| InChIKey | DPRHCPIWHGUSNH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |