C19H20N6O2 — CID 140543145
N-(4-methylpiperazin-1-yl)-6-(3-nitrophenyl)quinazolin-2-amine (PubChem CID 140543145) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-6-(3-nitrophenyl)quinazolin-2-amine.
| Compound Name | N-(4-methylpiperazin-1-yl)-6-(3-nitrophenyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 140543145 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-6-(3-nitrophenyl)quinazolin-2-amine |
| SMILES | CN1CCN(Nc2ncc3cc(-c4cccc([N+](=O)[O-])c4)ccc3n2)CC1 |
| InChI | InChI=1S/C19H20N6O2/c1-23-7-9-24(10-8-23)22-19-20-13-16-11-15(5-6-18(16)21-19)14-3-2-4-17(12-14)25(26)27/h2-6,11-13H,7-10H2,1H3,(H,20,21,22) |
| InChIKey | LJBQNKXRNFINFR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|