C20H23N5O — CID 140543179
[4-[2-[(4-methylpiperazin-1-yl)amino]quinazolin-6-yl]phenyl]methanol (PubChem CID 140543179) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is [4-[2-[(4-methylpiperazin-1-yl)amino]quinazolin-6-yl]phenyl]methanol.
| Compound Name | [4-[2-[(4-methylpiperazin-1-yl)amino]quinazolin-6-yl]phenyl]methanol |
|---|---|
| PubChem CID | 140543179 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | [4-[2-[(4-methylpiperazin-1-yl)amino]quinazolin-6-yl]phenyl]methanol |
| SMILES | CN1CCN(Nc2ncc3cc(-c4ccc(CO)cc4)ccc3n2)CC1 |
| InChI | InChI=1S/C20H23N5O/c1-24-8-10-25(11-9-24)23-20-21-13-18-12-17(6-7-19(18)22-20)16-4-2-15(14-26)3-5-16/h2-7,12-13,26H,8-11,14H2,1H3,(H,21,22,23) |
| InChIKey | VIPSRMXUDMMKBG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |