C20H16F2N2O4S — CID 177254612
5-fluoro-2-(4-fluoro-2-methylphenoxy)-3-(3-sulfamoylphenyl)benzamide (PubChem CID 177254612) has the molecular formula C20H16F2N2O4S and a molecular weight of 418.42 g/mol. Its IUPAC name is 5-fluoro-2-(4-fluoro-2-methylphenoxy)-3-(3-sulfamoylphenyl)benzamide.
| Compound Name | 5-fluoro-2-(4-fluoro-2-methylphenoxy)-3-(3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 177254612 |
| Molecular Formula | C20H16F2N2O4S |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 5-fluoro-2-(4-fluoro-2-methylphenoxy)-3-(3-sulfamoylphenyl)benzamide |
| SMILES | Cc1cc(F)ccc1Oc1c(C(N)=O)cc(F)cc1-c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H16F2N2O4S/c1-11-7-13(21)5-6-18(11)28-19-16(9-14(22)10-17(19)20(23)25)12-3-2-4-15(8-12)29(24,26)27/h2-10H,1H3,(H2,23,25)(H2,24,26,27) |
| InChIKey | LWLGCTUIGRAEKQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |