C18H30N2O3 — CID 177255639
[4,4-dimethyl-3-[methyl(2-phenylmethoxyethyl)amino]pentyl] carbamate (PubChem CID 177255639) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is [4,4-dimethyl-3-[methyl(2-phenylmethoxyethyl)amino]pentyl] carbamate.
| Compound Name | [4,4-dimethyl-3-[methyl(2-phenylmethoxyethyl)amino]pentyl] carbamate |
|---|---|
| PubChem CID | 177255639 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | [4,4-dimethyl-3-[methyl(2-phenylmethoxyethyl)amino]pentyl] carbamate |
| SMILES | CN(CCOCc1ccccc1)C(CCOC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C18H30N2O3/c1-18(2,3)16(10-12-23-17(19)21)20(4)11-13-22-14-15-8-6-5-7-9-15/h5-9,16H,10-14H2,1-4H3,(H2,19,21) |
| InChIKey | UTHFCEMLAVKKQW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|