C11H15N3S — CID 177255763
N'-(3-cyano-4-ethyl-5-methylthiophen-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 177255763) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is N'-(3-cyano-4-ethyl-5-methylthiophen-2-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(3-cyano-4-ethyl-5-methylthiophen-2-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 177255763 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N'-(3-cyano-4-ethyl-5-methylthiophen-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | CCc1c(C)sc(N=CN(C)C)c1C#N |
| InChI | InChI=1S/C11H15N3S/c1-5-9-8(2)15-11(10(9)6-12)13-7-14(3)4/h7H,5H2,1-4H3 |
| InChIKey | BHNKFFXUJUJMNI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|