C12H4ClF13Se — CID 177256158
1-chloro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylselanyl)benzene (PubChem CID 177256158) has the molecular formula C12H4ClF13Se and a molecular weight of 509.55 g/mol. Its IUPAC name is 1-chloro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylselanyl)benzene.
| Compound Name | 1-chloro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylselanyl)benzene |
|---|---|
| PubChem CID | 177256158 |
| Molecular Formula | C12H4ClF13Se |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.90 |
| IUPAC Name | 1-chloro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylselanyl)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[Se]c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H4ClF13Se/c13-5-1-3-6(4-2-5)27-12(25,26)10(20,21)8(16,17)7(14,15)9(18,19)11(22,23)24/h1-4H |
| InChIKey | KSYAMVQWUKAEGY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|