C9H18ClN — CID 177256401
methyl-penta-1,4-dien-3-yl-propylazanium chloride (PubChem CID 177256401) has the molecular formula C9H18ClN and a molecular weight of 175.70 g/mol. Its IUPAC name is methyl-penta-1,4-dien-3-yl-propylazanium chloride.
| Compound Name | methyl-penta-1,4-dien-3-yl-propylazanium chloride |
|---|---|
| PubChem CID | 177256401 |
| Molecular Formula | C9H18ClN |
| Molecular Weight | 175.70 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | methyl-penta-1,4-dien-3-yl-propylazanium chloride |
| SMILES | C=CC(C=C)[NH+](C)CCC.[Cl-] |
| InChI | InChI=1S/C9H17N.ClH/c1-5-8-10(4)9(6-2)7-3;/h6-7,9H,2-3,5,8H2,1,4H3;1H |
| InChIKey | QEKMSEHFCUDVSJ-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.70 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|