methyl-penta-1,4-dien-3-yl-propylazanium chloride

C9H18ClN — CID 177256401

IUPACmethyl-penta-1,4-dien-3-yl-propylazanium chloride
SMILESC=CC(C=C)[NH+](C)CCC.[Cl-]
InChIInChI=1S/C9H17N.ClH/c1-5-8-10(4)9(6-2)7-3;/h6-7,9H,2-3,5,8H2,1,4H3;1H
InChIKeyQEKMSEHFCUDVSJ-UHFFFAOYSA-N
MW175.70 g/mol
LogP-2.34
Rot. Bonds5

About methyl-penta-1,4-dien-3-yl-propylazanium chloride

methyl-penta-1,4-dien-3-yl-propylazanium chloride (PubChem CID 177256401) has the molecular formula C9H18ClN and a molecular weight of 175.70 g/mol. Its IUPAC name is methyl-penta-1,4-dien-3-yl-propylazanium chloride.

Molecular Properties

Compound Namemethyl-penta-1,4-dien-3-yl-propylazanium chloride
PubChem CID177256401
Molecular FormulaC9H18ClN
Molecular Weight175.70 g/mol
Exact Mass175.11
IUPAC Namemethyl-penta-1,4-dien-3-yl-propylazanium chloride
SMILESC=CC(C=C)[NH+](C)CCC.[Cl-]
InChIInChI=1S/C9H17N.ClH/c1-5-8-10(4)9(6-2)7-3;/h6-7,9H,2-3,5,8H2,1,4H3;1H
InChIKeyQEKMSEHFCUDVSJ-UHFFFAOYSA-N
XLogP-2.34
TPSA4.44 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds5
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.70
LogP ≤ 5-2.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl-penta-1,4-dien-3-yl-propylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl-penta-1,4-dien-3-yl-propylazanium chloride?
The IUPAC name of methyl-penta-1,4-dien-3-yl-propylazanium chloride (CID 177256401) is methyl-penta-1,4-dien-3-yl-propylazanium chloride.
What is the SMILES notation for methyl-penta-1,4-dien-3-yl-propylazanium chloride?
The canonical SMILES for methyl-penta-1,4-dien-3-yl-propylazanium chloride is C=CC(C=C)[NH+](C)CCC.[Cl-].
What is the InChIKey of methyl-penta-1,4-dien-3-yl-propylazanium chloride?
The InChIKey is QEKMSEHFCUDVSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.ClH/c1-5-8-10(4)9(6-2)7-3;/h6-7,9H,2-3,5,8H2,1,4H3;1H.
What are the key properties of methyl-penta-1,4-dien-3-yl-propylazanium chloride?
methyl-penta-1,4-dien-3-yl-propylazanium chloride has a molecular weight of 175.70 g/mol, XLogP of -2.34, 5 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-penta-1,4-dien-3-yl-propylazanium chloride is sourced from PubChem (CID 177256401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).