C45H84N2O5 — CID 177257118
5-O-heptadecan-9-yl 1-O-[2-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienyl]carbamoylamino]propyl] pentanedioate (PubChem CID 177257118) has the molecular formula C45H84N2O5 and a molecular weight of 733.18 g/mol. Its IUPAC name is 5-O-heptadecan-9-yl 1-O-[2-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienyl]carbamoylamino]propyl] pentanedioate.
| Compound Name | 5-O-heptadecan-9-yl 1-O-[2-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienyl]carbamoylamino]propyl] pentanedioate |
|---|---|
| PubChem CID | 177257118 |
| Molecular Formula | C45H84N2O5 |
| Molecular Weight | 733.18 g/mol |
| Exact Mass | 732.64 |
| IUPAC Name | 5-O-heptadecan-9-yl 1-O-[2-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienyl]carbamoylamino]propyl] pentanedioate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCNC(=O)NCC(C)COC(=O)CCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C45H84N2O5/c1-5-8-11-14-17-18-19-20-21-22-23-24-25-26-29-32-38-46-45(50)47-39-41(4)40-51-43(48)36-33-37-44(49)52-42(34-30-27-15-12-9-6-2)35-31-28-16-13-10-7-3/h17-18,20-21,41-42H,5-16,19,22-40H2,1-4H3,(H2,46,47,50)/b18-17-,21-20- |
| InChIKey | ROIZXDXXKGKIFB-KSWDIIKGSA-N |
| XLogP | 12.86 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.18 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|