C75H119F5N12O12 — CID 177258177
CID 177258177 (PubChem CID 177258177) has the molecular formula C75H119F5N12O12 and a molecular weight of 1475.84 g/mol.
| Compound Name | CID 177258177 |
|---|---|
| PubChem CID | 177258177 |
| Molecular Formula | C75H119F5N12O12 |
| Molecular Weight | 1475.84 g/mol |
| Exact Mass | 1474.90 |
| IUPAC Name | — |
| SMILES | CCC[C@H]1C(=O)N[C@@H]([C@@H](C)CC)C(=O)N(C)CC(=O)N(C)[C@H]2C/C=C\CCN(C2=O)[C@@H](CC2CCC(C)CC2)C(=O)N(C)CC(=O)N[C@@H](CCC2CC(F)C(C(F)(F)F)C(F)C2)C(=O)N2CC3(CC3)C[C@H]2C(=O)NC2(CC(C)(C)C2)C(=O)N(C)[C@@H]([C@@H](C)CC)C(=O)N(C)[C@H](C(=O)N(C)C)CC(=O)N1C |
| InChI | InChI=1S/C75H119F5N12O12/c1-17-23-52-63(96)82-61(45(5)18-2)69(102)86(12)40-59(95)88(14)53-24-21-20-22-33-91(68(53)101)55(36-47-27-25-44(4)26-28-47)67(100)85(11)39-57(93)81-51(30-29-48-34-49(76)60(50(77)35-48)75(78,79)80)65(98)92-43-73(31-32-73)38-56(92)64(97)83-74(41-72(7,8)42-74)71(104)90(16)62(46(6)19-3)70(103)89(15)54(66(99)84(9)10)37-58(94)87(52)13/h20-21,44-56,60-62H,17-19,22-43H2,1-16H3,(H,81,93)(H,82,96)(H,83,97)/b21-20-/t44?,45-,46-,47?,48?,49?,50?,51-,52-,53-,54-,55-,56-,60?,61-,62-/m0/s1 |
| InChIKey | NFAUWGHXOCBCQD-SMKSSVMESA-N |
| XLogP | 6.43 |
| TPSA | 270.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 104 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1475.84 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|