C75H117ClF6N12O12 — CID 177258893
CID 177258893 (PubChem CID 177258893) has the molecular formula C75H117ClF6N12O12 and a molecular weight of 1528.27 g/mol.
| Compound Name | CID 177258893 |
|---|---|
| PubChem CID | 177258893 |
| Molecular Formula | C75H117ClF6N12O12 |
| Molecular Weight | 1528.27 g/mol |
| Exact Mass | 1526.85 |
| IUPAC Name | — |
| SMILES | CCC[C@H]1C(=O)N[C@@H]([C@@H](C)CC)C(=O)N(C)CC(=O)N(C)[C@H]2C/C=C\CCN(C2=O)[C@@H](CC2CCC(C(F)(F)F)CC2)C(=O)N(C)CC(=O)N[C@@H](CCC2CCC(C(F)(F)F)C(Cl)C2)C(=O)N2CC3(CC3)C[C@H]2C(=O)NC2(CC(C)(C)C2)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@H](C(=O)N(C)C)CC(=O)N1C |
| InChI | InChI=1S/C75H117ClF6N12O12/c1-16-21-52-62(98)84-61(45(5)17-2)69(105)88(11)40-60(97)90(13)53-22-19-18-20-33-93(68(53)104)56(36-47-23-27-48(28-24-47)74(77,78)79)66(102)87(10)39-58(95)83-51(30-26-46-25-29-49(50(76)35-46)75(80,81)82)64(100)94-43-72(31-32-72)38-57(94)63(99)85-73(41-71(6,7)42-73)70(106)92(15)54(34-44(3)4)67(103)91(14)55(65(101)86(8)9)37-59(96)89(52)12/h18-19,44-57,61H,16-17,20-43H2,1-15H3,(H,83,95)(H,84,98)(H,85,99)/b19-18-/t45-,46?,47?,48?,49?,50?,51-,52-,53-,54-,55-,56-,57-,61-/m0/s1 |
| InChIKey | NGFCQKXGNKSHKT-BXGBNIFVSA-N |
| XLogP | 7.29 |
| TPSA | 270.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 106 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1528.27 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|