C22H26FN3O9 — CID 177261108
[3-[(2R,3R,4S,5S)-5-(2-ethylbutanoyloxymethyl)-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2,6-dioxopyrimidin-1-yl]methyl pyridine-3-carboxylate (PubChem CID 177261108) has the molecular formula C22H26FN3O9 and a molecular weight of 495.46 g/mol. Its IUPAC name is [3-[(2R,3R,4S,5S)-5-(2-ethylbutanoyloxymethyl)-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2,6-dioxopyrimidin-1-yl]methyl pyridine-3-carboxylate.
| Compound Name | [3-[(2R,3R,4S,5S)-5-(2-ethylbutanoyloxymethyl)-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2,6-dioxopyrimidin-1-yl]methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 177261108 |
| Molecular Formula | C22H26FN3O9 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | [3-[(2R,3R,4S,5S)-5-(2-ethylbutanoyloxymethyl)-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2,6-dioxopyrimidin-1-yl]methyl pyridine-3-carboxylate |
| SMILES | CCC(CC)C(=O)OC[C@@]1(F)O[C@@H](n2ccc(=O)n(COC(=O)c3cccnc3)c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H26FN3O9/c1-3-13(4-2)19(30)33-11-22(23)17(29)16(28)18(35-22)25-9-7-15(27)26(21(25)32)12-34-20(31)14-6-5-8-24-10-14/h5-10,13,16-18,28-29H,3-4,11-12H2,1-2H3/t16-,17+,18-,22-/m1/s1 |
| InChIKey | HJIXHEQHTRSMLL-WYADAEROSA-N |
| XLogP | 0.12 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |