C27H25FN6OS — CID 177261798
4-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-7-[[(2S,6S)-8-methyl-4-oxa-8,11-diazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-12-yl]amino]-2,3-dihydroisoindole-1-thione (PubChem CID 177261798) has the molecular formula C27H25FN6OS and a molecular weight of 500.60 g/mol. Its IUPAC name is 4-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-7-[[(2S,6S)-8-methyl-4-oxa-8,11-diazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-12-yl]amino]-2,3-dihydroisoindole-1-thione.
| Compound Name | 4-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-7-[[(2S,6S)-8-methyl-4-oxa-8,11-diazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-12-yl]amino]-2,3-dihydroisoindole-1-thione |
|---|---|
| PubChem CID | 177261798 |
| Molecular Formula | C27H25FN6OS |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 4-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-7-[[(2S,6S)-8-methyl-4-oxa-8,11-diazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-12-yl]amino]-2,3-dihydroisoindole-1-thione |
| SMILES | CN1Cc2nc(Nc3ccc(-c4cnc5cc(F)ccn45)c4c3C(=S)NC4)ccc2[C@H]2COC[C@@H]2C1 |
| InChI | InChI=1S/C27H25FN6OS/c1-33-11-15-13-35-14-20(15)17-3-5-24(32-22(17)12-33)31-21-4-2-18(19-9-30-27(36)26(19)21)23-10-29-25-8-16(28)6-7-34(23)25/h2-8,10,15,20H,9,11-14H2,1H3,(H,30,36)(H,31,32)/t15-,20-/m0/s1 |
| InChIKey | LPDDDKQWNJJJCT-YWZLYKJASA-N |
| XLogP | 4.23 |
| TPSA | 66.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|