C47H45BN2S — CID 177264294
6,11,17-tritert-butyl-25-(3-pyridin-2-ylphenyl)-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(25),3(8),4,6,9(27),10,12,15(20),16,18,22(26),23-dodecaene (PubChem CID 177264294) has the molecular formula C47H45BN2S and a molecular weight of 680.77 g/mol. Its IUPAC name is 6,11,17-tritert-butyl-25-(3-pyridin-2-ylphenyl)-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(25),3(8),4,6,9(27),10,12,15(20),16,18,22(26),23-dodecaene.
| Compound Name | 6,11,17-tritert-butyl-25-(3-pyridin-2-ylphenyl)-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(25),3(8),4,6,9(27),10,12,15(20),16,18,22(26),23-dodecaene |
|---|---|
| PubChem CID | 177264294 |
| Molecular Formula | C47H45BN2S |
| Molecular Weight | 680.77 g/mol |
| Exact Mass | 680.34 |
| IUPAC Name | 6,11,17-tritert-butyl-25-(3-pyridin-2-ylphenyl)-21-thia-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(25),3(8),4,6,9(27),10,12,15(20),16,18,22(26),23-dodecaene |
| SMILES | CC(C)(C)c1ccc2c(c1)B1c3c(ccc(-c4cccc(-c5ccccn5)c4)c3-n3c4ccc(C(C)(C)C)cc4c4cc(C(C)(C)C)cc1c43)S2 |
| InChI | InChI=1S/C47H45BN2S/c1-45(2,3)30-16-19-39-34(24-30)35-25-32(47(7,8)9)27-37-43(35)50(39)44-33(28-13-12-14-29(23-28)38-15-10-11-22-49-38)18-21-41-42(44)48(37)36-26-31(46(4,5)6)17-20-40(36)51-41/h10-27H,1-9H3 |
| InChIKey | XCOVUGFDYGNQHR-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.77 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|