C15H25NO — CID 177265644
4-tert-butyl-1-(2-oxaspiro[3.3]heptan-6-yl)-3,6-dihydro-2H-pyridine (PubChem CID 177265644) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 4-tert-butyl-1-(2-oxaspiro[3.3]heptan-6-yl)-3,6-dihydro-2H-pyridine.
| Compound Name | 4-tert-butyl-1-(2-oxaspiro[3.3]heptan-6-yl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 177265644 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 4-tert-butyl-1-(2-oxaspiro[3.3]heptan-6-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)(C)C1=CCN(C2CC3(COC3)C2)CC1 |
| InChI | InChI=1S/C15H25NO/c1-14(2,3)12-4-6-16(7-5-12)13-8-15(9-13)10-17-11-15/h4,13H,5-11H2,1-3H3 |
| InChIKey | RYQHVUMZEVOWIE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|