C27H30N4O — CID 177269118
2-methyl-5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-N-(1-quinolin-4-ylcyclopropyl)benzamide (PubChem CID 177269118) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-methyl-5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-N-(1-quinolin-4-ylcyclopropyl)benzamide.
| Compound Name | 2-methyl-5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-N-(1-quinolin-4-ylcyclopropyl)benzamide |
|---|---|
| PubChem CID | 177269118 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 2-methyl-5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-N-(1-quinolin-4-ylcyclopropyl)benzamide |
| SMILES | Cc1ccc(N2CC3CN(C)CC3C2)cc1C(=O)NC1(c2ccnc3ccccc23)CC1 |
| InChI | InChI=1S/C27H30N4O/c1-18-7-8-21(31-16-19-14-30(2)15-20(19)17-31)13-23(18)26(32)29-27(10-11-27)24-9-12-28-25-6-4-3-5-22(24)25/h3-9,12-13,19-20H,10-11,14-17H2,1-2H3,(H,29,32) |
| InChIKey | BUBSNGYLMZMVHM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |