C23H24N4O3 — CID 177269144
5-[3-(dihydroxyamino)azetidin-1-yl]-2-methyl-N-(1-quinolin-4-ylcyclopropyl)benzamide (PubChem CID 177269144) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 5-[3-(dihydroxyamino)azetidin-1-yl]-2-methyl-N-(1-quinolin-4-ylcyclopropyl)benzamide.
| Compound Name | 5-[3-(dihydroxyamino)azetidin-1-yl]-2-methyl-N-(1-quinolin-4-ylcyclopropyl)benzamide |
|---|---|
| PubChem CID | 177269144 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 5-[3-(dihydroxyamino)azetidin-1-yl]-2-methyl-N-(1-quinolin-4-ylcyclopropyl)benzamide |
| SMILES | Cc1ccc(N2CC(N(O)O)C2)cc1C(=O)NC1(c2ccnc3ccccc23)CC1 |
| InChI | InChI=1S/C23H24N4O3/c1-15-6-7-16(26-13-17(14-26)27(29)30)12-19(15)22(28)25-23(9-10-23)20-8-11-24-21-5-3-2-4-18(20)21/h2-8,11-12,17,29-30H,9-10,13-14H2,1H3,(H,25,28) |
| InChIKey | FBAVHYMZJRKFSV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|