C28H29NO5 — CID 177269526
12-[4-(hydroxymethylperoxymethyl)-3-methoxyphenyl]-9,9-dimethyl-7,8,10,12-tetrahydrobenzo[a]acridin-11-one (PubChem CID 177269526) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is 12-[4-(hydroxymethylperoxymethyl)-3-methoxyphenyl]-9,9-dimethyl-7,8,10,12-tetrahydrobenzo[a]acridin-11-one.
| Compound Name | 12-[4-(hydroxymethylperoxymethyl)-3-methoxyphenyl]-9,9-dimethyl-7,8,10,12-tetrahydrobenzo[a]acridin-11-one |
|---|---|
| PubChem CID | 177269526 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 12-[4-(hydroxymethylperoxymethyl)-3-methoxyphenyl]-9,9-dimethyl-7,8,10,12-tetrahydrobenzo[a]acridin-11-one |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)Nc3ccc4ccccc4c32)ccc1COOCO |
| InChI | InChI=1S/C28H29NO5/c1-28(2)13-22-27(23(31)14-28)25(18-8-9-19(15-33-34-16-30)24(12-18)32-3)26-20-7-5-4-6-17(20)10-11-21(26)29-22/h4-12,25,29-30H,13-16H2,1-3H3 |
| InChIKey | BXUPAKHVWUHOHY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|