C31H26N2O3 — CID 155490789
[3-(9,9-dimethyl-11-oxo-7,8,10,12-tetrahydrobenzo[a]acridin-12-yl)phenyl] pyridine-4-carboxylate (PubChem CID 155490789) has the molecular formula C31H26N2O3 and a molecular weight of 474.56 g/mol. Its IUPAC name is [3-(9,9-dimethyl-11-oxo-7,8,10,12-tetrahydrobenzo[a]acridin-12-yl)phenyl] pyridine-4-carboxylate.
| Compound Name | [3-(9,9-dimethyl-11-oxo-7,8,10,12-tetrahydrobenzo[a]acridin-12-yl)phenyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 155490789 |
| Molecular Formula | C31H26N2O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | [3-(9,9-dimethyl-11-oxo-7,8,10,12-tetrahydrobenzo[a]acridin-12-yl)phenyl] pyridine-4-carboxylate |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccc3ccccc3c1C2c1cccc(OC(=O)c2ccncc2)c1 |
| InChI | InChI=1S/C31H26N2O3/c1-31(2)17-25-29(26(34)18-31)27(28-23-9-4-3-6-19(23)10-11-24(28)33-25)21-7-5-8-22(16-21)36-30(35)20-12-14-32-15-13-20/h3-16,27,33H,17-18H2,1-2H3 |
| InChIKey | YQJAXUYBAUHSAK-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|