C36H21BrO — CID 177271094
2-[4-(10-bromo-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl)phenyl]naphtho[1,2-b][1]benzofuran (PubChem CID 177271094) has the molecular formula C36H21BrO and a molecular weight of 557.52 g/mol. Its IUPAC name is 2-[4-(10-bromo-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl)phenyl]naphtho[1,2-b][1]benzofuran.
| Compound Name | 2-[4-(10-bromo-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl)phenyl]naphtho[1,2-b][1]benzofuran |
|---|---|
| PubChem CID | 177271094 |
| Molecular Formula | C36H21BrO |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 2-[4-(10-bromo-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl)phenyl]naphtho[1,2-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc(-c4ccc5ccc6c7ccccc7oc6c5c4)cc3)c3c([2H])c([2H])c([2H])c([2H])c3c(Br)c2c1[2H] |
| InChI | InChI=1S/C36H21BrO/c37-35-29-10-3-1-8-27(29)34(28-9-2-4-11-30(28)35)24-16-13-22(14-17-24)25-18-15-23-19-20-31-26-7-5-6-12-33(26)38-36(31)32(23)21-25/h1-21H/i1D,2D,3D,4D,8D,9D,10D,11D |
| InChIKey | CFOIHRJRCLBZPT-IWVZRDHKSA-N |
| XLogP | 11.14 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|