C19H19ClF3N3O4 — CID 177272949
3-[(3R)-6-chloro-3,4-dihydro-2H-chromen-3-yl]-6-(2,2,2-trifluoroethoxy)-5,6,7,8-tetrahydropyrazolo[5,1-b][1,3]oxazepine-2-carboxamide (PubChem CID 177272949) has the molecular formula C19H19ClF3N3O4 and a molecular weight of 445.83 g/mol. Its IUPAC name is 3-[(3R)-6-chloro-3,4-dihydro-2H-chromen-3-yl]-6-(2,2,2-trifluoroethoxy)-5,6,7,8-tetrahydropyrazolo[5,1-b][1,3]oxazepine-2-carboxamide.
| Compound Name | 3-[(3R)-6-chloro-3,4-dihydro-2H-chromen-3-yl]-6-(2,2,2-trifluoroethoxy)-5,6,7,8-tetrahydropyrazolo[5,1-b][1,3]oxazepine-2-carboxamide |
|---|---|
| PubChem CID | 177272949 |
| Molecular Formula | C19H19ClF3N3O4 |
| Molecular Weight | 445.83 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 3-[(3R)-6-chloro-3,4-dihydro-2H-chromen-3-yl]-6-(2,2,2-trifluoroethoxy)-5,6,7,8-tetrahydropyrazolo[5,1-b][1,3]oxazepine-2-carboxamide |
| SMILES | NC(=O)c1nn2c(c1[C@@H]1COc3ccc(Cl)cc3C1)OCC(OCC(F)(F)F)CC2 |
| InChI | InChI=1S/C19H19ClF3N3O4/c20-12-1-2-14-10(6-12)5-11(7-28-14)15-16(17(24)27)25-26-4-3-13(8-29-18(15)26)30-9-19(21,22)23/h1-2,6,11,13H,3-5,7-9H2,(H2,24,27)/t11-,13?/m0/s1 |
| InChIKey | OVGOOJBGHGMEJX-AMGKYWFPSA-N |
| XLogP | 3.08 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.83 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |