C30H29NO6 — CID 177277346
(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-(4-prop-2-enoxycarbonylphenyl)butanoic acid (PubChem CID 177277346) has the molecular formula C30H29NO6 and a molecular weight of 499.56 g/mol. Its IUPAC name is (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-(4-prop-2-enoxycarbonylphenyl)butanoic acid.
| Compound Name | (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-(4-prop-2-enoxycarbonylphenyl)butanoic acid |
|---|---|
| PubChem CID | 177277346 |
| Molecular Formula | C30H29NO6 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-(4-prop-2-enoxycarbonylphenyl)butanoic acid |
| SMILES | C=CCOC(=O)c1ccc(CC[C@H](C(=O)O)N(C)C(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C30H29NO6/c1-3-18-36-29(34)21-15-12-20(13-16-21)14-17-27(28(32)33)31(2)30(35)37-19-26-24-10-6-4-8-22(24)23-9-5-7-11-25(23)26/h3-13,15-16,26-27H,1,14,17-19H2,2H3,(H,32,33)/t27-/m1/s1 |
| InChIKey | BDHOZWGHFAQXOP-HHHXNRCGSA-N |
| XLogP | 5.30 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|