C34H39NO4 — CID 146517450
cyclooctyl (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-phenylbutanoate (PubChem CID 146517450) has the molecular formula C34H39NO4 and a molecular weight of 525.69 g/mol. Its IUPAC name is cyclooctyl (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-phenylbutanoate.
| Compound Name | cyclooctyl (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 146517450 |
| Molecular Formula | C34H39NO4 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | cyclooctyl (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-phenylbutanoate |
| SMILES | CN(C(=O)OCC1c2ccccc2-c2ccccc21)[C@@H](CCc1ccccc1)C(=O)OC1CCCCCCC1 |
| InChI | InChI=1S/C34H39NO4/c1-35(34(37)38-24-31-29-20-12-10-18-27(29)28-19-11-13-21-30(28)31)32(23-22-25-14-6-5-7-15-25)33(36)39-26-16-8-3-2-4-9-17-26/h5-7,10-15,18-21,26,31-32H,2-4,8-9,16-17,22-24H2,1H3/t32-/m0/s1 |
| InChIKey | VTOCCJQLCBTLCU-YTTGMZPUSA-N |
| XLogP | 7.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |