C15H25NO — CID 177282549
2-(2,2-dimethylpropoxy)-5-(2,2-dimethylpropyl)pyridine (PubChem CID 177282549) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-(2,2-dimethylpropoxy)-5-(2,2-dimethylpropyl)pyridine.
| Compound Name | 2-(2,2-dimethylpropoxy)-5-(2,2-dimethylpropyl)pyridine |
|---|---|
| PubChem CID | 177282549 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2-(2,2-dimethylpropoxy)-5-(2,2-dimethylpropyl)pyridine |
| SMILES | CC(C)(C)COc1ccc(CC(C)(C)C)cn1 |
| InChI | InChI=1S/C15H25NO/c1-14(2,3)9-12-7-8-13(16-10-12)17-11-15(4,5)6/h7-8,10H,9,11H2,1-6H3 |
| InChIKey | XHKVXINRIVTFNT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |