C12H24N2O — CID 177284279
2,2-dimethylpropyl N-methylpiperidine-1-carboximidate (PubChem CID 177284279) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 2,2-dimethylpropyl N-methylpiperidine-1-carboximidate.
| Compound Name | 2,2-dimethylpropyl N-methylpiperidine-1-carboximidate |
|---|---|
| PubChem CID | 177284279 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2,2-dimethylpropyl N-methylpiperidine-1-carboximidate |
| SMILES | C/N=C(\OCC(C)(C)C)N1CCCCC1 |
| InChI | InChI=1S/C12H24N2O/c1-12(2,3)10-15-11(13-4)14-8-6-5-7-9-14/h5-10H2,1-4H3/b13-11- |
| InChIKey | DXWDSCAAHFGOPX-QBFSEMIESA-N |
| XLogP | 2.52 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|