C24H29F4N5O2 — CID 177284531
7-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-3-fluorophenyl]-2-(hydroxymethyl)-5,5-dimethyl-4-(2,2,2-trifluoroethylamino)pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 177284531) has the molecular formula C24H29F4N5O2 and a molecular weight of 495.52 g/mol. Its IUPAC name is 7-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-3-fluorophenyl]-2-(hydroxymethyl)-5,5-dimethyl-4-(2,2,2-trifluoroethylamino)pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 7-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-3-fluorophenyl]-2-(hydroxymethyl)-5,5-dimethyl-4-(2,2,2-trifluoroethylamino)pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 177284531 |
| Molecular Formula | C24H29F4N5O2 |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 7-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-3-fluorophenyl]-2-(hydroxymethyl)-5,5-dimethyl-4-(2,2,2-trifluoroethylamino)pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | C[C@@H]1C[C@H](C)CN(c2ccc(N3C(=O)C(C)(C)c4c(NCC(F)(F)F)nc(CO)nc43)cc2F)C1 |
| InChI | InChI=1S/C24H29F4N5O2/c1-13-7-14(2)10-32(9-13)17-6-5-15(8-16(17)25)33-21-19(23(3,4)22(33)35)20(29-12-24(26,27)28)30-18(11-34)31-21/h5-6,8,13-14,34H,7,9-12H2,1-4H3,(H,29,30,31)/t13-,14+ |
| InChIKey | CWINVDGCEMOYDK-OKILXGFUSA-N |
| XLogP | 4.52 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|