C54H55B3N4O4 — CID 177285758
2-[3-[3-[2-tert-butyl-6-(4,6-ditert-butyl-1,3,5,2,4,6-trioxatriborinan-2-yl)phenyl]-2H-benzimidazol-1-yl]phenoxy]-6-phenyl-9-pyridin-2-ylcarbazole (PubChem CID 177285758) has the molecular formula C54H55B3N4O4 and a molecular weight of 856.49 g/mol. Its IUPAC name is 2-[3-[3-[2-tert-butyl-6-(4,6-ditert-butyl-1,3,5,2,4,6-trioxatriborinan-2-yl)phenyl]-2H-benzimidazol-1-yl]phenoxy]-6-phenyl-9-pyridin-2-ylcarbazole.
| Compound Name | 2-[3-[3-[2-tert-butyl-6-(4,6-ditert-butyl-1,3,5,2,4,6-trioxatriborinan-2-yl)phenyl]-2H-benzimidazol-1-yl]phenoxy]-6-phenyl-9-pyridin-2-ylcarbazole |
|---|---|
| PubChem CID | 177285758 |
| Molecular Formula | C54H55B3N4O4 |
| Molecular Weight | 856.49 g/mol |
| Exact Mass | 856.45 |
| IUPAC Name | 2-[3-[3-[2-tert-butyl-6-(4,6-ditert-butyl-1,3,5,2,4,6-trioxatriborinan-2-yl)phenyl]-2H-benzimidazol-1-yl]phenoxy]-6-phenyl-9-pyridin-2-ylcarbazole |
| SMILES | CC(C)(C)B1OB(c2cccc(C(C)(C)C)c2N2CN(c3cccc(Oc4ccc5c6cc(-c7ccccc7)ccc6n(-c6ccccn6)c5c4)c3)c3ccccc32)OB(C(C)(C)C)O1 |
| InChI | InChI=1S/C54H55B3N4O4/c1-52(2,3)44-23-18-24-45(55-63-56(53(4,5)6)65-57(64-55)54(7,8)9)51(44)60-36-59(47-25-13-14-26-48(47)60)39-21-17-22-40(34-39)62-41-29-30-42-43-33-38(37-19-11-10-12-20-37)28-31-46(43)61(49(42)35-41)50-27-15-16-32-58-50/h10-35H,36H2,1-9H3 |
| InChIKey | TVSOVLHVLPWICS-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 61.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.49 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|