C56H68B6N4O7 — CID 177285782
2-[3-[3-[2,6-bis(4,6-ditert-butyl-1,3,5,2,4,6-trioxatriborinan-2-yl)phenyl]-2H-benzimidazol-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole (PubChem CID 177285782) has the molecular formula C56H68B6N4O7 and a molecular weight of 974.05 g/mol. Its IUPAC name is 2-[3-[3-[2,6-bis(4,6-ditert-butyl-1,3,5,2,4,6-trioxatriborinan-2-yl)phenyl]-2H-benzimidazol-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-[3-[2,6-bis(4,6-ditert-butyl-1,3,5,2,4,6-trioxatriborinan-2-yl)phenyl]-2H-benzimidazol-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 177285782 |
| Molecular Formula | C56H68B6N4O7 |
| Molecular Weight | 974.05 g/mol |
| Exact Mass | 974.56 |
| IUPAC Name | 2-[3-[3-[2,6-bis(4,6-ditert-butyl-1,3,5,2,4,6-trioxatriborinan-2-yl)phenyl]-2H-benzimidazol-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
| SMILES | CC(C)(C)B1OB(c2cccc(B3OB(C(C)(C)C)OB(C(C)(C)C)O3)c2N2CN(c3cccc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)c3ccccc32)OB(C(C)(C)C)O1 |
| InChI | InChI=1S/C56H68B6N4O7/c1-52(2,3)38-32-33-63-50(34-38)66-46-27-17-16-24-42(46)43-31-30-41(36-49(43)66)67-40-23-20-22-39(35-40)64-37-65(48-29-19-18-28-47(48)64)51-44(57-68-59(53(4,5)6)72-60(69-57)54(7,8)9)25-21-26-45(51)58-70-61(55(10,11)12)73-62(71-58)56(13,14)15/h16-36H,37H2,1-15H3 |
| InChIKey | MAKMUTZZMYLJTB-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 88.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.05 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|