C46H31NS — CID 177287333
N-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-[1,3,6,7,8-pentadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]phenyl]dibenzothiophen-1-amine (PubChem CID 177287333) has the molecular formula C46H31NS and a molecular weight of 643.91 g/mol. Its IUPAC name is N-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-[1,3,6,7,8-pentadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]phenyl]dibenzothiophen-1-amine.
| Compound Name | N-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-[1,3,6,7,8-pentadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]phenyl]dibenzothiophen-1-amine |
|---|---|
| PubChem CID | 177287333 |
| Molecular Formula | C46H31NS |
| Molecular Weight | 643.91 g/mol |
| Exact Mass | 643.31 |
| IUPAC Name | N-(4-phenylphenyl)-N-[2,3,5,6-tetradeuterio-4-[1,3,6,7,8-pentadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]phenyl]dibenzothiophen-1-amine |
| SMILES | [2H]c1cc2c(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c([2H])c(-c3c([2H])c([2H])c(N(c4ccc(-c5ccccc5)cc4)c4cccc5sc6ccccc6c45)c([2H])c3[2H])c([2H])c2c([2H])c1[2H] |
| InChI | InChI=1S/C46H31NS/c1-3-12-32(13-4-1)33-22-26-38(27-23-33)47(43-19-11-21-45-46(43)41-18-9-10-20-44(41)48-45)39-28-24-34(25-29-39)37-30-36-16-7-8-17-40(36)42(31-37)35-14-5-2-6-15-35/h1-31H/i2D,5D,6D,7D,8D,14D,15D,16D,24D,25D,28D,29D,30D,31D |
| InChIKey | MRZSJJKEJGQZIO-DVXMGLLBSA-N |
| XLogP | 13.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.91 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |