C30H21NO — CID 177287383
1,2,3,7,8,9-hexadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)-N-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzofuran-4-amine (PubChem CID 177287383) has the molecular formula C30H21NO and a molecular weight of 431.63 g/mol. Its IUPAC name is 1,2,3,7,8,9-hexadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)-N-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzofuran-4-amine.
| Compound Name | 1,2,3,7,8,9-hexadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)-N-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzofuran-4-amine |
|---|---|
| PubChem CID | 177287383 |
| Molecular Formula | C30H21NO |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | 1,2,3,7,8,9-hexadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)-N-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzofuran-4-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c(Nc3c([2H])c([2H])c([2H])c4c3oc3c(-c5c([2H])c([2H])c([2H])c([2H])c5[2H])c([2H])c([2H])c([2H])c34)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C30H21NO/c1-3-10-21(11-4-1)23-14-7-15-24(20-23)31-28-19-9-18-27-26-17-8-16-25(29(26)32-30(27)28)22-12-5-2-6-13-22/h1-20,31H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D,17D,18D,19D,20D |
| InChIKey | QCJGRSTZOCRKBP-LODXIBBESA-N |
| XLogP | 8.66 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |