C24H19N — CID 177069730
2,3,4,5,6-pentadeuterio-N-[2,3,4,5-tetradeuterio-6-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]aniline (PubChem CID 177069730) has the molecular formula C24H19N and a molecular weight of 339.53 g/mol. Its IUPAC name is 2,3,4,5,6-pentadeuterio-N-[2,3,4,5-tetradeuterio-6-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]aniline.
| Compound Name | 2,3,4,5,6-pentadeuterio-N-[2,3,4,5-tetradeuterio-6-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 177069730 |
| Molecular Formula | C24H19N |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 2,3,4,5,6-pentadeuterio-N-[2,3,4,5-tetradeuterio-6-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c(Nc2c([2H])c([2H])c([2H])c([2H])c2-c2c([2H])c([2H])c([2H])c([2H])c2-c2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C24H19N/c1-3-11-19(12-4-1)21-15-7-8-16-22(21)23-17-9-10-18-24(23)25-20-13-5-2-6-14-20/h1-18,25H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D,17D,18D |
| InChIKey | WJOZUXJBWJTHQQ-QICNJPGCSA-N |
| XLogP | 6.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |