C32H23N — CID 140891939
4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]naphthalen-2-amine (PubChem CID 140891939) has the molecular formula C32H23N and a molecular weight of 431.60 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]naphthalen-2-amine.
| Compound Name | 4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]naphthalen-2-amine |
|---|---|
| PubChem CID | 140891939 |
| Molecular Formula | C32H23N |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]naphthalen-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(Nc3cc(-c4c([2H])c([2H])c([2H])c([2H])c4[2H])c4ccccc4c3)cc3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C32H23N/c1-3-11-23(12-4-1)31-21-27(19-25-15-7-9-17-29(25)31)33-28-20-26-16-8-10-18-30(26)32(22-28)24-13-5-2-6-14-24/h1-22,33H/i1D,2D,3D,4D,5D,6D,11D,12D,13D,14D |
| InChIKey | TZGFLKWUCFYYLX-IGSHGBDJSA-N |
| XLogP | 9.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |