C14H14 — CID 167703253
1,2,3,4,5-pentadeuterio-6-(2,3,4-trideuterio-5,6-dimethylphenyl)benzene (PubChem CID 167703253) has the molecular formula C14H14 and a molecular weight of 190.31 g/mol. Its IUPAC name is 1,2,3,4,5-pentadeuterio-6-(2,3,4-trideuterio-5,6-dimethylphenyl)benzene.
| Compound Name | 1,2,3,4,5-pentadeuterio-6-(2,3,4-trideuterio-5,6-dimethylphenyl)benzene |
|---|---|
| PubChem CID | 167703253 |
| Molecular Formula | C14H14 |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(2,3,4-trideuterio-5,6-dimethylphenyl)benzene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c(C)c2C)c([2H])c1[2H] |
| InChI | InChI=1S/C14H14/c1-11-7-6-10-14(12(11)2)13-8-4-3-5-9-13/h3-10H,1-2H3/i3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | HCAHMRPMYBVHGU-UWAUJQNOSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |