C43H26O — CID 88865416
4,12-bis[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(18),2,4,6,8(17),9,11,13,15-nonaen-19-one (PubChem CID 88865416) has the molecular formula C43H26O and a molecular weight of 576.79 g/mol. Its IUPAC name is 4,12-bis[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(18),2,4,6,8(17),9,11,13,15-nonaen-19-one.
| Compound Name | 4,12-bis[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(18),2,4,6,8(17),9,11,13,15-nonaen-19-one |
|---|---|
| PubChem CID | 88865416 |
| Molecular Formula | C43H26O |
| Molecular Weight | 576.79 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | 4,12-bis[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(18),2,4,6,8(17),9,11,13,15-nonaen-19-one |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c([2H])c2-c2ccc3c4c2ccc2ccc5c(-c6c([2H])c([2H])c([2H])c([2H])c6-c6c([2H])c([2H])c([2H])c([2H])c6[2H])ccc(c5c24)C3=O)c([2H])c1[2H] |
| InChI | InChI=1S/C43H26O/c44-43-38-25-23-34(32-17-9-7-15-30(32)27-11-3-1-4-12-27)36-21-19-29-20-22-37-35(24-26-39(43)42(37)40(29)41(36)38)33-18-10-8-16-31(33)28-13-5-2-6-14-28/h1-26H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D,17D,18D |
| InChIKey | UWSBGYBYSGGIFR-QICNJPGCSA-N |
| XLogP | 11.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.79 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|