C46H28 — CID 177072074
1,2,3,4,5,6,8,9,10,11-decadeuterio-12-pyren-1-yl-7-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzo[a]anthracene (PubChem CID 177072074) has the molecular formula C46H28 and a molecular weight of 599.85 g/mol. Its IUPAC name is 1,2,3,4,5,6,8,9,10,11-decadeuterio-12-pyren-1-yl-7-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzo[a]anthracene.
| Compound Name | 1,2,3,4,5,6,8,9,10,11-decadeuterio-12-pyren-1-yl-7-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzo[a]anthracene |
|---|---|
| PubChem CID | 177072074 |
| Molecular Formula | C46H28 |
| Molecular Weight | 599.85 g/mol |
| Exact Mass | 599.34 |
| IUPAC Name | 1,2,3,4,5,6,8,9,10,11-decadeuterio-12-pyren-1-yl-7-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzo[a]anthracene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c([2H])c2-c2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc4ccc5cccc6ccc3c4c56)c3c2c([2H])c([2H])c2c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C46H28/c1-2-11-29(12-3-1)34-16-6-7-18-36(34)44-37-19-8-9-20-38(37)46(45-35-17-5-4-13-30(35)23-28-41(44)45)40-27-25-33-22-21-31-14-10-15-32-24-26-39(40)43(33)42(31)32/h1-28H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,11D,12D,13D,16D,17D,18D,19D,20D,23D,28D |
| InChIKey | KOTNLKKZMGBQOM-RMWABYIJSA-N |
| XLogP | 13.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.85 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|