C40H24 — CID 177071717
1,2,3,4,5,6,7,8,9,10,11-undecadeuterio-12-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-2-yl]benzo[a]anthracene (PubChem CID 177071717) has the molecular formula C40H24 and a molecular weight of 520.73 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,10,11-undecadeuterio-12-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-2-yl]benzo[a]anthracene.
| Compound Name | 1,2,3,4,5,6,7,8,9,10,11-undecadeuterio-12-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-2-yl]benzo[a]anthracene |
|---|---|
| PubChem CID | 177071717 |
| Molecular Formula | C40H24 |
| Molecular Weight | 520.73 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,10,11-undecadeuterio-12-[6-(2,3,4,5,6-pentadeuteriophenyl)pyren-2-yl]benzo[a]anthracene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3ccc4cc(-c5c6c([2H])c([2H])c([2H])c([2H])c6c([2H])c6c([2H])c([2H])c7c([2H])c([2H])c([2H])c([2H])c7c56)cc5ccc2c3c45)c([2H])c1[2H] |
| InChI | InChI=1S/C40H24/c1-2-8-25(9-3-1)33-20-18-27-15-17-29-23-32(24-30-19-21-36(33)38(27)37(29)30)40-35-13-7-5-11-28(35)22-31-16-14-26-10-4-6-12-34(26)39(31)40/h1-24H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,16D,22D |
| InChIKey | LEKIROVWSUZASM-FIZCCBSFSA-N |
| XLogP | 11.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.73 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|