C34H20 — CID 177071512
1,2,3,4,5,6,8,9,10,11,12-undecadeuterio-7-pyren-4-ylbenzo[a]anthracene (PubChem CID 177071512) has the molecular formula C34H20 and a molecular weight of 439.60 g/mol. Its IUPAC name is 1,2,3,4,5,6,8,9,10,11,12-undecadeuterio-7-pyren-4-ylbenzo[a]anthracene.
| Compound Name | 1,2,3,4,5,6,8,9,10,11,12-undecadeuterio-7-pyren-4-ylbenzo[a]anthracene |
|---|---|
| PubChem CID | 177071512 |
| Molecular Formula | C34H20 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 1,2,3,4,5,6,8,9,10,11,12-undecadeuterio-7-pyren-4-ylbenzo[a]anthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c3c(c([2H])c([2H])c4c([2H])c([2H])c([2H])c([2H])c43)c(-c3cc4cccc5ccc6cccc3c6c54)c2c1[2H] |
| InChI | InChI=1S/C34H20/c1-3-12-26-21(7-1)17-18-29-30(26)19-24-8-2-4-13-27(24)34(29)31-20-25-11-5-9-22-15-16-23-10-6-14-28(31)33(23)32(22)25/h1-20H/i1D,2D,3D,4D,7D,8D,12D,13D,17D,18D,19D |
| InChIKey | ZFMARLDZPOCXHG-XOZVBMIVSA-N |
| XLogP | 9.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|