C30H26O — CID 177288031
1-[8-[1,1-bis(4-ethenylphenyl)ethyl]naphthalen-1-yl]ethanone (PubChem CID 177288031) has the molecular formula C30H26O and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-[8-[1,1-bis(4-ethenylphenyl)ethyl]naphthalen-1-yl]ethanone.
| Compound Name | 1-[8-[1,1-bis(4-ethenylphenyl)ethyl]naphthalen-1-yl]ethanone |
|---|---|
| PubChem CID | 177288031 |
| Molecular Formula | C30H26O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 1-[8-[1,1-bis(4-ethenylphenyl)ethyl]naphthalen-1-yl]ethanone |
| SMILES | C=Cc1ccc(C(C)(c2ccc(C=C)cc2)c2cccc3cccc(C(C)=O)c23)cc1 |
| InChI | InChI=1S/C30H26O/c1-5-22-13-17-25(18-14-22)30(4,26-19-15-23(6-2)16-20-26)28-12-8-10-24-9-7-11-27(21(3)31)29(24)28/h5-20H,1-2H2,3-4H3 |
| InChIKey | YESQJRNIWYOGFS-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|