C27H23F2N7O — CID 177288598
1-[(1S,8R)-4-(4-fluoro-3,5-dimethylphenyl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-3-yl]-3-(5-fluorophthalazin-6-yl)imidazol-2-one (PubChem CID 177288598) has the molecular formula C27H23F2N7O and a molecular weight of 499.53 g/mol. Its IUPAC name is 1-[(1S,8R)-4-(4-fluoro-3,5-dimethylphenyl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-3-yl]-3-(5-fluorophthalazin-6-yl)imidazol-2-one.
| Compound Name | 1-[(1S,8R)-4-(4-fluoro-3,5-dimethylphenyl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-3-yl]-3-(5-fluorophthalazin-6-yl)imidazol-2-one |
|---|---|
| PubChem CID | 177288598 |
| Molecular Formula | C27H23F2N7O |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 1-[(1S,8R)-4-(4-fluoro-3,5-dimethylphenyl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-3-yl]-3-(5-fluorophthalazin-6-yl)imidazol-2-one |
| SMILES | Cc1cc(-n2nc3c(c2-n2ccn(-c4ccc5cnncc5c4F)c2=O)[C@@H]2CC[C@H](C3)N2)cc(C)c1F |
| InChI | InChI=1S/C27H23F2N7O/c1-14-9-18(10-15(2)24(14)28)36-26(23-20-5-4-17(32-20)11-21(23)33-36)35-8-7-34(27(35)37)22-6-3-16-12-30-31-13-19(16)25(22)29/h3,6-10,12-13,17,20,32H,4-5,11H2,1-2H3/t17-,20+/m1/s1 |
| InChIKey | UWDDIQVSKNMZIL-XLIONFOSSA-N |
| XLogP | 4.00 |
| TPSA | 82.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |