C26H23F2N7O — CID 177359011
1-[(1R)-4-(4-fluoro-3,5-dimethylphenyl)-4,5,9-triazatricyclo[6.1.1.02,6]deca-2,5-dien-3-yl]-3-(4-fluoro-1-methylindazol-5-yl)imidazol-2-one (PubChem CID 177359011) has the molecular formula C26H23F2N7O and a molecular weight of 487.51 g/mol. Its IUPAC name is 1-[(1R)-4-(4-fluoro-3,5-dimethylphenyl)-4,5,9-triazatricyclo[6.1.1.02,6]deca-2,5-dien-3-yl]-3-(4-fluoro-1-methylindazol-5-yl)imidazol-2-one.
| Compound Name | 1-[(1R)-4-(4-fluoro-3,5-dimethylphenyl)-4,5,9-triazatricyclo[6.1.1.02,6]deca-2,5-dien-3-yl]-3-(4-fluoro-1-methylindazol-5-yl)imidazol-2-one |
|---|---|
| PubChem CID | 177359011 |
| Molecular Formula | C26H23F2N7O |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 1-[(1R)-4-(4-fluoro-3,5-dimethylphenyl)-4,5,9-triazatricyclo[6.1.1.02,6]deca-2,5-dien-3-yl]-3-(4-fluoro-1-methylindazol-5-yl)imidazol-2-one |
| SMILES | Cc1cc(-n2nc3c(c2-n2ccn(-c4ccc5c(cnn5C)c4F)c2=O)[C@H]2CC(C3)N2)cc(C)c1F |
| InChI | InChI=1S/C26H23F2N7O/c1-13-8-16(9-14(2)23(13)27)35-25(22-18-10-15(30-18)11-19(22)31-35)34-7-6-33(26(34)36)21-5-4-20-17(24(21)28)12-29-32(20)3/h4-9,12,15,18,30H,10-11H2,1-3H3/t15?,18-/m1/s1 |
| InChIKey | RNNYJIHTMLZSLS-KPMSDPLLSA-N |
| XLogP | 3.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |