C31H28FNO6 — CID 177291795
methyl (2S)-2-[(2-fluoro-6-methylbenzoyl)amino]-3-[5-(3-formyl-2,6-dimethoxyphenyl)naphthalen-1-yl]propanoate (PubChem CID 177291795) has the molecular formula C31H28FNO6 and a molecular weight of 529.56 g/mol. Its IUPAC name is methyl (2S)-2-[(2-fluoro-6-methylbenzoyl)amino]-3-[5-(3-formyl-2,6-dimethoxyphenyl)naphthalen-1-yl]propanoate.
| Compound Name | methyl (2S)-2-[(2-fluoro-6-methylbenzoyl)amino]-3-[5-(3-formyl-2,6-dimethoxyphenyl)naphthalen-1-yl]propanoate |
|---|---|
| PubChem CID | 177291795 |
| Molecular Formula | C31H28FNO6 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | methyl (2S)-2-[(2-fluoro-6-methylbenzoyl)amino]-3-[5-(3-formyl-2,6-dimethoxyphenyl)naphthalen-1-yl]propanoate |
| SMILES | COC(=O)[C@H](Cc1cccc2c(-c3c(OC)ccc(C=O)c3OC)cccc12)NC(=O)c1c(C)cccc1F |
| InChI | InChI=1S/C31H28FNO6/c1-18-8-5-13-24(32)27(18)30(35)33-25(31(36)39-4)16-19-9-6-11-22-21(19)10-7-12-23(22)28-26(37-2)15-14-20(17-34)29(28)38-3/h5-15,17,25H,16H2,1-4H3,(H,33,35)/t25-/m0/s1 |
| InChIKey | QFBHYBLQYMAIKD-VWLOTQADSA-N |
| XLogP | 5.30 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|