C22H24O3 — CID 170588240
2,4-dimethoxy-3-(5-methylnaphthalen-1-yl)benzaldehyde;ethane (PubChem CID 170588240) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2,4-dimethoxy-3-(5-methylnaphthalen-1-yl)benzaldehyde;ethane.
| Compound Name | 2,4-dimethoxy-3-(5-methylnaphthalen-1-yl)benzaldehyde;ethane |
|---|---|
| PubChem CID | 170588240 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2,4-dimethoxy-3-(5-methylnaphthalen-1-yl)benzaldehyde;ethane |
| SMILES | CC.COc1ccc(C=O)c(OC)c1-c1cccc2c(C)cccc12 |
| InChI | InChI=1S/C20H18O3.C2H6/c1-13-6-4-8-16-15(13)7-5-9-17(16)19-18(22-2)11-10-14(12-21)20(19)23-3;1-2/h4-12H,1-3H3;1-2H3 |
| InChIKey | LDARYDQCCHSDJT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|