C44H89N5O7 — CID 177295729
3-[3-[bis[3-(decylamino)-2-hydroxy-3-oxopropyl]amino]propyl-(2-hydroxyethyl)amino]-N-decyl-2-hydroxypropanamide (PubChem CID 177295729) has the molecular formula C44H89N5O7 and a molecular weight of 800.22 g/mol. Its IUPAC name is 3-[3-[bis[3-(decylamino)-2-hydroxy-3-oxopropyl]amino]propyl-(2-hydroxyethyl)amino]-N-decyl-2-hydroxypropanamide.
| Compound Name | 3-[3-[bis[3-(decylamino)-2-hydroxy-3-oxopropyl]amino]propyl-(2-hydroxyethyl)amino]-N-decyl-2-hydroxypropanamide |
|---|---|
| PubChem CID | 177295729 |
| Molecular Formula | C44H89N5O7 |
| Molecular Weight | 800.22 g/mol |
| Exact Mass | 799.68 |
| IUPAC Name | 3-[3-[bis[3-(decylamino)-2-hydroxy-3-oxopropyl]amino]propyl-(2-hydroxyethyl)amino]-N-decyl-2-hydroxypropanamide |
| SMILES | CCCCCCCCCCNC(=O)C(O)CN(CCO)CCCN(CC(O)C(=O)NCCCCCCCCCC)CC(O)C(=O)NCCCCCCCCCC |
| InChI | InChI=1S/C44H89N5O7/c1-4-7-10-13-16-19-22-25-29-45-42(54)39(51)36-48(34-35-50)32-28-33-49(37-40(52)43(55)46-30-26-23-20-17-14-11-8-5-2)38-41(53)44(56)47-31-27-24-21-18-15-12-9-6-3/h39-41,50-53H,4-38H2,1-3H3,(H,45,54)(H,46,55)(H,47,56) |
| InChIKey | BAVVWYHSNBCCIC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 174.70 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.22 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|