C71H137N5O13 — CID 177295731
pentadecan-8-yl 4-[[3-[3-[bis[2-hydroxy-3-oxo-3-[(4-oxo-4-pentadecan-8-yloxybutyl)amino]propyl]amino]propyl-(2-hydroxyethyl)amino]-2-hydroxypropanoyl]amino]butanoate (PubChem CID 177295731) has the molecular formula C71H137N5O13 and a molecular weight of 1268.90 g/mol. Its IUPAC name is pentadecan-8-yl 4-[[3-[3-[bis[2-hydroxy-3-oxo-3-[(4-oxo-4-pentadecan-8-yloxybutyl)amino]propyl]amino]propyl-(2-hydroxyethyl)amino]-2-hydroxypropanoyl]amino]butanoate.
| Compound Name | pentadecan-8-yl 4-[[3-[3-[bis[2-hydroxy-3-oxo-3-[(4-oxo-4-pentadecan-8-yloxybutyl)amino]propyl]amino]propyl-(2-hydroxyethyl)amino]-2-hydroxypropanoyl]amino]butanoate |
|---|---|
| PubChem CID | 177295731 |
| Molecular Formula | C71H137N5O13 |
| Molecular Weight | 1268.90 g/mol |
| Exact Mass | 1268.02 |
| IUPAC Name | pentadecan-8-yl 4-[[3-[3-[bis[2-hydroxy-3-oxo-3-[(4-oxo-4-pentadecan-8-yloxybutyl)amino]propyl]amino]propyl-(2-hydroxyethyl)amino]-2-hydroxypropanoyl]amino]butanoate |
| SMILES | CCCCCCCC(CCCCCCC)OC(=O)CCCNC(=O)C(O)CN(CCO)CCCN(CC(O)C(=O)NCCCC(=O)OC(CCCCCCC)CCCCCCC)CC(O)C(=O)NCCCC(=O)OC(CCCCCCC)CCCCCCC |
| InChI | InChI=1S/C71H137N5O13/c1-7-13-19-25-31-41-60(42-32-26-20-14-8-2)87-66(81)47-37-50-72-69(84)63(78)57-75(55-56-77)53-40-54-76(58-64(79)70(85)73-51-38-48-67(82)88-61(43-33-27-21-15-9-3)44-34-28-22-16-10-4)59-65(80)71(86)74-52-39-49-68(83)89-62(45-35-29-23-17-11-5)46-36-30-24-18-12-6/h60-65,77-80H,7-59H2,1-6H3,(H,72,84)(H,73,85)(H,74,86) |
| InChIKey | NVFNRLWFBVYZOZ-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 253.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 66 |
| Heavy Atoms | 89 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1268.90 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|