C47H93N3O9 — CID 177295753
decyl 3-[3-[bis(3-decoxy-2-hydroxy-3-oxopropyl)amino]propyl-[3-(dimethylamino)propyl]amino]-2-hydroxypropanoate (PubChem CID 177295753) has the molecular formula C47H93N3O9 and a molecular weight of 844.27 g/mol. Its IUPAC name is decyl 3-[3-[bis(3-decoxy-2-hydroxy-3-oxopropyl)amino]propyl-[3-(dimethylamino)propyl]amino]-2-hydroxypropanoate.
| Compound Name | decyl 3-[3-[bis(3-decoxy-2-hydroxy-3-oxopropyl)amino]propyl-[3-(dimethylamino)propyl]amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 177295753 |
| Molecular Formula | C47H93N3O9 |
| Molecular Weight | 844.27 g/mol |
| Exact Mass | 843.69 |
| IUPAC Name | decyl 3-[3-[bis(3-decoxy-2-hydroxy-3-oxopropyl)amino]propyl-[3-(dimethylamino)propyl]amino]-2-hydroxypropanoate |
| SMILES | CCCCCCCCCCOC(=O)C(O)CN(CCCN(C)C)CCCN(CC(O)C(=O)OCCCCCCCCCC)CC(O)C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C47H93N3O9/c1-6-9-12-15-18-21-24-27-36-57-45(54)42(51)39-49(33-30-32-48(4)5)34-31-35-50(40-43(52)46(55)58-37-28-25-22-19-16-13-10-7-2)41-44(53)47(56)59-38-29-26-23-20-17-14-11-8-3/h42-44,51-53H,6-41H2,1-5H3 |
| InChIKey | UNUBPKVVGPPJQD-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.27 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|