C75H145N5O15 — CID 176741179
decyl 3-[2-[bis(3-decoxy-2-hydroxy-3-oxopropyl)amino]ethyl-[2-[4-[2-[bis(3-decoxy-2-hydroxy-3-oxopropyl)amino]ethyl]piperazin-1-yl]ethyl]amino]-2-hydroxypropanoate (PubChem CID 176741179) has the molecular formula C75H145N5O15 and a molecular weight of 1357.00 g/mol. Its IUPAC name is decyl 3-[2-[bis(3-decoxy-2-hydroxy-3-oxopropyl)amino]ethyl-[2-[4-[2-[bis(3-decoxy-2-hydroxy-3-oxopropyl)amino]ethyl]piperazin-1-yl]ethyl]amino]-2-hydroxypropanoate.
| Compound Name | decyl 3-[2-[bis(3-decoxy-2-hydroxy-3-oxopropyl)amino]ethyl-[2-[4-[2-[bis(3-decoxy-2-hydroxy-3-oxopropyl)amino]ethyl]piperazin-1-yl]ethyl]amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 176741179 |
| Molecular Formula | C75H145N5O15 |
| Molecular Weight | 1357.00 g/mol |
| Exact Mass | 1356.07 |
| IUPAC Name | decyl 3-[2-[bis(3-decoxy-2-hydroxy-3-oxopropyl)amino]ethyl-[2-[4-[2-[bis(3-decoxy-2-hydroxy-3-oxopropyl)amino]ethyl]piperazin-1-yl]ethyl]amino]-2-hydroxypropanoate |
| SMILES | CCCCCCCCCCOC(=O)C(O)CN(CCN1CCN(CCN(CC(O)C(=O)OCCCCCCCCCC)CC(O)C(=O)OCCCCCCCCCC)CC1)CCN(CC(O)C(=O)OCCCCCCCCCC)CC(O)C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C75H145N5O15/c1-6-11-16-21-26-31-36-41-56-91-71(86)66(81)61-78(53-55-80(64-69(84)74(89)94-59-44-39-34-29-24-19-14-9-4)65-70(85)75(90)95-60-45-40-35-30-25-20-15-10-5)52-50-76-46-48-77(49-47-76)51-54-79(62-67(82)72(87)92-57-42-37-32-27-22-17-12-7-2)63-68(83)73(88)93-58-43-38-33-28-23-18-13-8-3/h66-70,81-85H,6-65H2,1-5H3 |
| InChIKey | DKUFSBJHXCUULJ-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 248.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 69 |
| Heavy Atoms | 95 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1357.00 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|