C54H105N3O15 — CID 176741166
6-(hexoxymethoxy)hexyl 3-[4-[2-[bis[3-[6-(hexoxymethoxy)hexoxy]-2-hydroxy-3-oxopropyl]amino]ethyl]piperazin-1-yl]-2-hydroxypropanoate (PubChem CID 176741166) has the molecular formula C54H105N3O15 and a molecular weight of 1036.44 g/mol. Its IUPAC name is 6-(hexoxymethoxy)hexyl 3-[4-[2-[bis[3-[6-(hexoxymethoxy)hexoxy]-2-hydroxy-3-oxopropyl]amino]ethyl]piperazin-1-yl]-2-hydroxypropanoate.
| Compound Name | 6-(hexoxymethoxy)hexyl 3-[4-[2-[bis[3-[6-(hexoxymethoxy)hexoxy]-2-hydroxy-3-oxopropyl]amino]ethyl]piperazin-1-yl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 176741166 |
| Molecular Formula | C54H105N3O15 |
| Molecular Weight | 1036.44 g/mol |
| Exact Mass | 1035.75 |
| IUPAC Name | 6-(hexoxymethoxy)hexyl 3-[4-[2-[bis[3-[6-(hexoxymethoxy)hexoxy]-2-hydroxy-3-oxopropyl]amino]ethyl]piperazin-1-yl]-2-hydroxypropanoate |
| SMILES | CCCCCCOCOCCCCCCOC(=O)C(O)CN1CCN(CCN(CC(O)C(=O)OCCCCCCOCOCCCCCC)CC(O)C(=O)OCCCCCCOCOCCCCCC)CC1 |
| InChI | InChI=1S/C54H105N3O15/c1-4-7-10-19-34-64-46-67-37-22-13-16-25-40-70-52(61)49(58)43-56-31-28-55(29-32-56)30-33-57(44-50(59)53(62)71-41-26-17-14-23-38-68-47-65-35-20-11-8-5-2)45-51(60)54(63)72-42-27-18-15-24-39-69-48-66-36-21-12-9-6-3/h49-51,58-60H,4-48H2,1-3H3 |
| InChIKey | DJYJAEWGMMYVGN-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 204.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.44 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|