C26H33Cl2N3O4S — CID 177295794
(4S,7S,8S,9S)-13-(3,5-dichlorophenyl)sulfonyl-8-ethenyl-4-(4-methylpiperidine-1-carbonyl)-3,13-diazatricyclo[7.3.1.03,7]tridecan-2-one (PubChem CID 177295794) has the molecular formula C26H33Cl2N3O4S and a molecular weight of 554.54 g/mol. Its IUPAC name is (4S,7S,8S,9S)-13-(3,5-dichlorophenyl)sulfonyl-8-ethenyl-4-(4-methylpiperidine-1-carbonyl)-3,13-diazatricyclo[7.3.1.03,7]tridecan-2-one.
| Compound Name | (4S,7S,8S,9S)-13-(3,5-dichlorophenyl)sulfonyl-8-ethenyl-4-(4-methylpiperidine-1-carbonyl)-3,13-diazatricyclo[7.3.1.03,7]tridecan-2-one |
|---|---|
| PubChem CID | 177295794 |
| Molecular Formula | C26H33Cl2N3O4S |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | (4S,7S,8S,9S)-13-(3,5-dichlorophenyl)sulfonyl-8-ethenyl-4-(4-methylpiperidine-1-carbonyl)-3,13-diazatricyclo[7.3.1.03,7]tridecan-2-one |
| SMILES | C=C[C@H]1[C@@H]2CC[C@@H](C(=O)N3CCC(C)CC3)N2C(=O)C2CCC[C@@H]1N2S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C26H33Cl2N3O4S/c1-3-20-21-7-8-23(25(32)29-11-9-16(2)10-12-29)30(21)26(33)24-6-4-5-22(20)31(24)36(34,35)19-14-17(27)13-18(28)15-19/h3,13-16,20-24H,1,4-12H2,2H3/t20-,21-,22-,23-,24?/m0/s1 |
| InChIKey | ZDFCLTATLBTPKV-KYWCHSSTSA-N |
| XLogP | 4.34 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|