C56H37N4O2Pt-3 — CID 177303570
CID 177303570 (PubChem CID 177303570) has the molecular formula C56H37N4O2Pt-3 and a molecular weight of 999.05 g/mol.
| Compound Name | CID 177303570 |
|---|---|
| PubChem CID | 177303570 |
| Molecular Formula | C56H37N4O2Pt-3 |
| Molecular Weight | 999.05 g/mol |
| Exact Mass | 998.30 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1ccc2c(c1)c1ccc3[c-]c1n2-c1cc(C([2H])([2H])[2H])c(cn1)-c1ccccc1Oc1cccc(c1)-c1cccc(-c2ccccc2)c1N1[CH-]N(c2[c-]c(ccc2)O3)c2ccccc21.[Pt] |
| InChI | InChI=1S/C56H37N4O2.Pt/c1-36-25-28-50-48(29-36)46-27-26-43-33-53(46)60(50)55-30-37(2)49(34-57-55)47-19-6-9-24-54(47)62-41-17-10-15-39(31-41)45-21-12-20-44(38-13-4-3-5-14-38)56(45)59-35-58(51-22-7-8-23-52(51)59)40-16-11-18-42(32-40)61-43;/h3-31,34-35H,1-2H3;/q-3;/i1D3,2D3; |
| InChIKey | IRBOUMLJPLGZHN-TXHXQZCNSA-N |
| XLogP | 14.70 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.05 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|